C20H23BF4O3 — CID 175569295
[4-(3,5-ditert-butylphenyl)-2,3,5,6-tetrafluorophenoxy]boronic acid (PubChem CID 175569295) has the molecular formula C20H23BF4O3 and a molecular weight of 398.21 g/mol. Its IUPAC name is [4-(3,5-ditert-butylphenyl)-2,3,5,6-tetrafluorophenoxy]boronic acid.
| Compound Name | [4-(3,5-ditert-butylphenyl)-2,3,5,6-tetrafluorophenoxy]boronic acid |
|---|---|
| PubChem CID | 175569295 |
| Molecular Formula | C20H23BF4O3 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [4-(3,5-ditert-butylphenyl)-2,3,5,6-tetrafluorophenoxy]boronic acid |
| SMILES | CC(C)(C)c1cc(-c2c(F)c(F)c(OB(O)O)c(F)c2F)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H23BF4O3/c1-19(2,3)11-7-10(8-12(9-11)20(4,5)6)13-14(22)16(24)18(28-21(26)27)17(25)15(13)23/h7-9,26-27H,1-6H3 |
| InChIKey | BAAOMQCFRMAJKC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|