About 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine
6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine (PubChem CID 175569331) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 175569331 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine |
| SMILES | CCc1cc2c(n1C)CN(C(C)(C)C)CC2 |
| InChI | InChI=1S/C14H24N2/c1-6-12-9-11-7-8-16(14(2,3)4)10-13(11)15(12)5/h9H,6-8,10H2,1-5H3 |
| InChIKey | CMDJEKKRFHOTKM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine (CID 175569331) is 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine is CCc1cc2c(n1C)CN(C(C)(C)C)CC2.
What is the InChIKey of 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine?
The InChIKey is CMDJEKKRFHOTKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-6-12-9-11-7-8-16(14(2,3)4)10-13(11)15(12)5/h9H,6-8,10H2,1-5H3.
What are the key properties of 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine?
6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine has a molecular weight of 220.36 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-ethyl-1-methyl-5,7-dihydro-4H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 175569331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).