About acetonitrile;nonane;tetrafluoroborate
acetonitrile;nonane;tetrafluoroborate (PubChem CID 175569585) has the molecular formula C11H23BF4N-
and a molecular weight of 256.12 g/mol. Its IUPAC name is acetonitrile;nonane;tetrafluoroborate.
Molecular Properties
| Compound Name | acetonitrile;nonane;tetrafluoroborate |
| PubChem CID | 175569585 |
| Molecular Formula | C11H23BF4N- |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | acetonitrile;nonane;tetrafluoroborate |
| SMILES | CC#N.CCCCCCCCC.F[B-](F)(F)F |
| InChI | InChI=1S/C9H20.C2H3N.BF4/c1-3-5-7-9-8-6-4-2;1-2-3;2-1(3,4)5/h3-9H2,1-2H3;1H3;/q;;-1 |
| InChIKey | RFEZMFJBWOKURW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;nonane;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;nonane;tetrafluoroborate?
The IUPAC name of acetonitrile;nonane;tetrafluoroborate (CID 175569585) is acetonitrile;nonane;tetrafluoroborate.
What is the SMILES notation for acetonitrile;nonane;tetrafluoroborate?
The canonical SMILES for acetonitrile;nonane;tetrafluoroborate is CC#N.CCCCCCCCC.F[B-](F)(F)F.
What is the InChIKey of acetonitrile;nonane;tetrafluoroborate?
The InChIKey is RFEZMFJBWOKURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C2H3N.BF4/c1-3-5-7-9-8-6-4-2;1-2-3;2-1(3,4)5/h3-9H2,1-2H3;1H3;/q;;-1.
What are the key properties of acetonitrile;nonane;tetrafluoroborate?
acetonitrile;nonane;tetrafluoroborate has a molecular weight of 256.12 g/mol, XLogP of 5.59, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;nonane;tetrafluoroborate is sourced from PubChem (CID 175569585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).