C34H45F6N5O3 — CID 175570768
N-[1,1-dicyclohexyl-3-[2-fluoro-4-[1-oxo-1-(1,2,2,3,3-pentafluoropropylamino)propan-2-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 175570768) has the molecular formula C34H45F6N5O3 and a molecular weight of 685.75 g/mol. Its IUPAC name is N-[1,1-dicyclohexyl-3-[2-fluoro-4-[1-oxo-1-(1,2,2,3,3-pentafluoropropylamino)propan-2-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[1,1-dicyclohexyl-3-[2-fluoro-4-[1-oxo-1-(1,2,2,3,3-pentafluoropropylamino)propan-2-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175570768 |
| Molecular Formula | C34H45F6N5O3 |
| Molecular Weight | 685.75 g/mol |
| Exact Mass | 685.34 |
| IUPAC Name | N-[1,1-dicyclohexyl-3-[2-fluoro-4-[1-oxo-1-(1,2,2,3,3-pentafluoropropylamino)propan-2-yl]anilino]-3-oxopropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C(=O)NC(F)C(F)(F)C(F)F)c1ccc(NC(=O)C(NC(=O)c2ccnn2C(C)C)C(C2CCCCC2)C2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C34H45F6N5O3/c1-19(2)45-26(16-17-41-45)30(47)43-28(27(21-10-6-4-7-11-21)22-12-8-5-9-13-22)31(48)42-25-15-14-23(18-24(25)35)20(3)29(46)44-33(38)34(39,40)32(36)37/h14-22,27-28,32-33H,4-13H2,1-3H3,(H,42,48)(H,43,47)(H,44,46) |
| InChIKey | SOQMZBZXHNNPKP-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.75 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|