8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid

C13H12N4O2 — CID 175571301

IUPAC8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid
SMILESCCn1c2ccc(N)cc2c2c(C(=O)O)nncc21
InChIInChI=1S/C13H12N4O2/c1-2-17-9-4-3-7(14)5-8(9)11-10(17)6-15-16-12(11)13(18)19/h3-6H,2,14H2,1H3,(H,18,19)
InChIKeyKDQURPSKXDYBRN-UHFFFAOYSA-N
MW256.26 g/mol
LogP1.88
Rot. Bonds2

About 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid

8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid (PubChem CID 175571301) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid.

Molecular Properties

Compound Name8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid
PubChem CID175571301
Molecular FormulaC13H12N4O2
Molecular Weight256.26 g/mol
Exact Mass256.10
IUPAC Name8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid
SMILESCCn1c2ccc(N)cc2c2c(C(=O)O)nncc21
InChIInChI=1S/C13H12N4O2/c1-2-17-9-4-3-7(14)5-8(9)11-10(17)6-15-16-12(11)13(18)19/h3-6H,2,14H2,1H3,(H,18,19)
InChIKeyKDQURPSKXDYBRN-UHFFFAOYSA-N
XLogP1.88
TPSA94.03 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.26
LogP ≤ 51.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid?
The IUPAC name of 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid (CID 175571301) is 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid.
What is the SMILES notation for 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid?
The canonical SMILES for 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid is CCn1c2ccc(N)cc2c2c(C(=O)O)nncc21.
What is the InChIKey of 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid?
The InChIKey is KDQURPSKXDYBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O2/c1-2-17-9-4-3-7(14)5-8(9)11-10(17)6-15-16-12(11)13(18)19/h3-6H,2,14H2,1H3,(H,18,19).
What are the key properties of 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid?
8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid has a molecular weight of 256.26 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-5-ethylpyridazino[4,5-b]indole-1-carboxylic acid is sourced from PubChem (CID 175571301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).