About 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride
3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride (PubChem CID 175571367) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride |
| PubChem CID | 175571367 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride |
| SMILES | C=CC1CCN(CC(O)CO)CC1.Cl |
| InChI | InChI=1S/C10H19NO2.ClH/c1-2-9-3-5-11(6-4-9)7-10(13)8-12;/h2,9-10,12-13H,1,3-8H2;1H |
| InChIKey | GWNNZQGOXRGQLC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride?
The IUPAC name of 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride (CID 175571367) is 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride.
What is the SMILES notation for 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride?
The canonical SMILES for 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride is C=CC1CCN(CC(O)CO)CC1.Cl.
What is the InChIKey of 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride?
The InChIKey is GWNNZQGOXRGQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.ClH/c1-2-9-3-5-11(6-4-9)7-10(13)8-12;/h2,9-10,12-13H,1,3-8H2;1H.
What are the key properties of 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride?
3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride has a molecular weight of 221.73 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethenylpiperidin-1-yl)propane-1,2-diol;hydrochloride is sourced from PubChem (CID 175571367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).