About 2-(ethylamino)acetyl isocyanate
2-(ethylamino)acetyl isocyanate (PubChem CID 175571461) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-(ethylamino)acetyl isocyanate.
Molecular Properties
| Compound Name | 2-(ethylamino)acetyl isocyanate |
| PubChem CID | 175571461 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2-(ethylamino)acetyl isocyanate |
| SMILES | CCNCC(=O)N=C=O |
| InChI | InChI=1S/C5H8N2O2/c1-2-6-3-5(9)7-4-8/h6H,2-3H2,1H3 |
| InChIKey | HNOHYRJDPBMIIA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylamino)acetyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)acetyl isocyanate?
The IUPAC name of 2-(ethylamino)acetyl isocyanate (CID 175571461) is 2-(ethylamino)acetyl isocyanate.
What is the SMILES notation for 2-(ethylamino)acetyl isocyanate?
The canonical SMILES for 2-(ethylamino)acetyl isocyanate is CCNCC(=O)N=C=O.
What is the InChIKey of 2-(ethylamino)acetyl isocyanate?
The InChIKey is HNOHYRJDPBMIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-2-6-3-5(9)7-4-8/h6H,2-3H2,1H3.
What are the key properties of 2-(ethylamino)acetyl isocyanate?
2-(ethylamino)acetyl isocyanate has a molecular weight of 128.13 g/mol, XLogP of -0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)acetyl isocyanate is sourced from PubChem (CID 175571461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).