C44H60O12 — CID 175571670
benzoic acid;2-methylheptane-3,5-diol;3-methylheptane-3,5-diol (PubChem CID 175571670) has the molecular formula C44H60O12 and a molecular weight of 780.95 g/mol. Its IUPAC name is benzoic acid;2-methylheptane-3,5-diol;3-methylheptane-3,5-diol.
| Compound Name | benzoic acid;2-methylheptane-3,5-diol;3-methylheptane-3,5-diol |
|---|---|
| PubChem CID | 175571670 |
| Molecular Formula | C44H60O12 |
| Molecular Weight | 780.95 g/mol |
| Exact Mass | 780.41 |
| IUPAC Name | benzoic acid;2-methylheptane-3,5-diol;3-methylheptane-3,5-diol |
| SMILES | CCC(O)CC(C)(O)CC.CCC(O)CC(O)C(C)C.O=C(O)c1ccccc1.O=C(O)c1ccccc1.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/2C8H18O2.4C7H6O2/c1-4-7(9)5-8(10)6(2)3;1-4-7(9)6-8(3,10)5-2;4*8-7(9)6-4-2-1-3-5-6/h6-10H,4-5H2,1-3H3;7,9-10H,4-6H2,1-3H3;4*1-5H,(H,8,9) |
| InChIKey | QKLYEWYRUGTLQU-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 230.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.95 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |