C20H38NiO4 — CID 175572173
bis(2,2-diethylhexanoate);nickel(2+) (PubChem CID 175572173) has the molecular formula C20H38NiO4 and a molecular weight of 401.21 g/mol. Its IUPAC name is bis(2,2-diethylhexanoate);nickel(2+).
| Compound Name | bis(2,2-diethylhexanoate);nickel(2+) |
|---|---|
| PubChem CID | 175572173 |
| Molecular Formula | C20H38NiO4 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | bis(2,2-diethylhexanoate);nickel(2+) |
| SMILES | CCCCC(CC)(CC)C(=O)[O-].CCCCC(CC)(CC)C(=O)[O-].[Ni+2] |
| InChI | InChI=1S/2C10H20O2.Ni/c2*1-4-7-8-10(5-2,6-3)9(11)12;/h2*4-8H2,1-3H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | CZBFVHIZXKXUDW-UHFFFAOYSA-L |
| XLogP | 3.46 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |