C23H29N3O5 — CID 175572183
4-[2-[bis[(3-methoxyphenyl)methyl]amino]-2-oxoethyl]piperazine-1-carboxylic acid (PubChem CID 175572183) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-[2-[bis[(3-methoxyphenyl)methyl]amino]-2-oxoethyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-[bis[(3-methoxyphenyl)methyl]amino]-2-oxoethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175572183 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-[2-[bis[(3-methoxyphenyl)methyl]amino]-2-oxoethyl]piperazine-1-carboxylic acid |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)C(=O)CN2CCN(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C23H29N3O5/c1-30-20-7-3-5-18(13-20)15-26(16-19-6-4-8-21(14-19)31-2)22(27)17-24-9-11-25(12-10-24)23(28)29/h3-8,13-14H,9-12,15-17H2,1-2H3,(H,28,29) |
| InChIKey | OIFAOVBKBFOALX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |