About 2-(benzenesulfonyl)-1-phenylethanone;fluoroform
2-(benzenesulfonyl)-1-phenylethanone;fluoroform (PubChem CID 175573425) has the molecular formula C15H13F3O3S
and a molecular weight of 330.33 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-phenylethanone;fluoroform.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-1-phenylethanone;fluoroform |
| PubChem CID | 175573425 |
| Molecular Formula | C15H13F3O3S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(benzenesulfonyl)-1-phenylethanone;fluoroform |
| SMILES | FC(F)F.O=C(CS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3S.CHF3/c15-14(12-7-3-1-4-8-12)11-18(16,17)13-9-5-2-6-10-13;2-1(3)4/h1-10H,11H2;1H |
| InChIKey | YZHGEPPTQMBUQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-1-phenylethanone;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-1-phenylethanone;fluoroform?
The IUPAC name of 2-(benzenesulfonyl)-1-phenylethanone;fluoroform (CID 175573425) is 2-(benzenesulfonyl)-1-phenylethanone;fluoroform.
What is the SMILES notation for 2-(benzenesulfonyl)-1-phenylethanone;fluoroform?
The canonical SMILES for 2-(benzenesulfonyl)-1-phenylethanone;fluoroform is FC(F)F.O=C(CS(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)-1-phenylethanone;fluoroform?
The InChIKey is YZHGEPPTQMBUQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3S.CHF3/c15-14(12-7-3-1-4-8-12)11-18(16,17)13-9-5-2-6-10-13;2-1(3)4/h1-10H,11H2;1H.
What are the key properties of 2-(benzenesulfonyl)-1-phenylethanone;fluoroform?
2-(benzenesulfonyl)-1-phenylethanone;fluoroform has a molecular weight of 330.33 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-1-phenylethanone;fluoroform is sourced from PubChem (CID 175573425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).