C21H19ClFN7O2 — CID 175573664
(1R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(6-aminopurin-9-yl)cyclopent-3-ene-1,2-diol (PubChem CID 175573664) has the molecular formula C21H19ClFN7O2 and a molecular weight of 455.88 g/mol. Its IUPAC name is (1R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(6-aminopurin-9-yl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(6-aminopurin-9-yl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 175573664 |
| Molecular Formula | C21H19ClFN7O2 |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (1R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(6-aminopurin-9-yl)cyclopent-3-ene-1,2-diol |
| SMILES | Nc1nc2cc(CCC3=CC(n4cnc5c(N)ncnc54)[C@@H](O)C3O)cc(F)c2cc1Cl |
| InChI | InChI=1S/C21H19ClFN7O2/c22-12-6-11-13(23)3-9(4-14(11)29-19(12)24)1-2-10-5-15(18(32)17(10)31)30-8-28-16-20(25)26-7-27-21(16)30/h3-8,15,17-18,31-32H,1-2H2,(H2,24,29)(H2,25,26,27)/t15?,17?,18-/m1/s1 |
| InChIKey | FRQIXUZKRWPLNM-VMWRSERWSA-N |
| XLogP | 2.17 |
| TPSA | 148.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|