About amino 2-methylpent-2-enoate;piperidine
amino 2-methylpent-2-enoate;piperidine (PubChem CID 175574358) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is amino 2-methylpent-2-enoate;piperidine.
Molecular Properties
| Compound Name | amino 2-methylpent-2-enoate;piperidine |
| PubChem CID | 175574358 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | amino 2-methylpent-2-enoate;piperidine |
| SMILES | C1CCNCC1.CCC=C(C)C(=O)ON |
| InChI | InChI=1S/C6H11NO2.C5H11N/c1-3-4-5(2)6(8)9-7;1-2-4-6-5-3-1/h4H,3,7H2,1-2H3;6H,1-5H2 |
| InChIKey | DJAJBSUXNGUNOP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 2-methylpent-2-enoate;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 2-methylpent-2-enoate;piperidine?
The IUPAC name of amino 2-methylpent-2-enoate;piperidine (CID 175574358) is amino 2-methylpent-2-enoate;piperidine.
What is the SMILES notation for amino 2-methylpent-2-enoate;piperidine?
The canonical SMILES for amino 2-methylpent-2-enoate;piperidine is C1CCNCC1.CCC=C(C)C(=O)ON.
What is the InChIKey of amino 2-methylpent-2-enoate;piperidine?
The InChIKey is DJAJBSUXNGUNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C5H11N/c1-3-4-5(2)6(8)9-7;1-2-4-6-5-3-1/h4H,3,7H2,1-2H3;6H,1-5H2.
What are the key properties of amino 2-methylpent-2-enoate;piperidine?
amino 2-methylpent-2-enoate;piperidine has a molecular weight of 214.31 g/mol, XLogP of 1.52, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-methylpent-2-enoate;piperidine is sourced from PubChem (CID 175574358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).