C12H14N4O3 — CID 175574528
2-methyl-6-morpholin-2-yl-3H-pyrido[4,3-d]pyrimidine-4,7-dione (PubChem CID 175574528) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-methyl-6-morpholin-2-yl-3H-pyrido[4,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-methyl-6-morpholin-2-yl-3H-pyrido[4,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 175574528 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-methyl-6-morpholin-2-yl-3H-pyrido[4,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1nc2cc(=O)n(C3CNCCO3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N4O3/c1-7-14-9-4-10(17)16(6-8(9)12(18)15-7)11-5-13-2-3-19-11/h4,6,11,13H,2-3,5H2,1H3,(H,14,15,18) |
| InChIKey | OCKKJKOWDNPMGD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |