About azane;4-(1,3-thiazol-2-yl)phenol
azane;4-(1,3-thiazol-2-yl)phenol (PubChem CID 175575077) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is azane;4-(1,3-thiazol-2-yl)phenol.
Molecular Properties
| Compound Name | azane;4-(1,3-thiazol-2-yl)phenol |
| PubChem CID | 175575077 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | azane;4-(1,3-thiazol-2-yl)phenol |
| SMILES | N.Oc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C9H7NOS.H3N/c11-8-3-1-7(2-4-8)9-10-5-6-12-9;/h1-6,11H;1H3 |
| InChIKey | SMYOQCPYFANVOB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;4-(1,3-thiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(1,3-thiazol-2-yl)phenol?
The IUPAC name of azane;4-(1,3-thiazol-2-yl)phenol (CID 175575077) is azane;4-(1,3-thiazol-2-yl)phenol.
What is the SMILES notation for azane;4-(1,3-thiazol-2-yl)phenol?
The canonical SMILES for azane;4-(1,3-thiazol-2-yl)phenol is N.Oc1ccc(-c2nccs2)cc1.
What is the InChIKey of azane;4-(1,3-thiazol-2-yl)phenol?
The InChIKey is SMYOQCPYFANVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NOS.H3N/c11-8-3-1-7(2-4-8)9-10-5-6-12-9;/h1-6,11H;1H3.
What are the key properties of azane;4-(1,3-thiazol-2-yl)phenol?
azane;4-(1,3-thiazol-2-yl)phenol has a molecular weight of 194.26 g/mol, XLogP of 2.68, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(1,3-thiazol-2-yl)phenol is sourced from PubChem (CID 175575077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).