C34H30O9 — CID 175575220
2-(2-ethylphenyl)-6-[[(5S,6S,7R,8S)-2-(2-ethylphenyl)-6,7,8-trihydroxy-4-oxo-5,6,7,8-tetrahydrochromen-5-yl]oxy]-7-hydroxychromen-4-one (PubChem CID 175575220) has the molecular formula C34H30O9 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-6-[[(5S,6S,7R,8S)-2-(2-ethylphenyl)-6,7,8-trihydroxy-4-oxo-5,6,7,8-tetrahydrochromen-5-yl]oxy]-7-hydroxychromen-4-one.
| Compound Name | 2-(2-ethylphenyl)-6-[[(5S,6S,7R,8S)-2-(2-ethylphenyl)-6,7,8-trihydroxy-4-oxo-5,6,7,8-tetrahydrochromen-5-yl]oxy]-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 175575220 |
| Molecular Formula | C34H30O9 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 2-(2-ethylphenyl)-6-[[(5S,6S,7R,8S)-2-(2-ethylphenyl)-6,7,8-trihydroxy-4-oxo-5,6,7,8-tetrahydrochromen-5-yl]oxy]-7-hydroxychromen-4-one |
| SMILES | CCc1ccccc1-c1cc(=O)c2c(o1)[C@@H](O)[C@H](O)[C@H](O)[C@H]2Oc1cc2c(=O)cc(-c3ccccc3CC)oc2cc1O |
| InChI | InChI=1S/C34H30O9/c1-3-17-9-5-7-11-19(17)25-14-22(35)21-13-28(23(36)15-27(21)41-25)43-34-29-24(37)16-26(20-12-8-6-10-18(20)4-2)42-33(29)31(39)30(38)32(34)40/h5-16,30-32,34,36,38-40H,3-4H2,1-2H3/t30-,31-,32-,34-/m0/s1 |
| InChIKey | XHSHBSFLXQYXSF-SUGCFTRWSA-N |
| XLogP | 4.80 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |