C45H30N4O — CID 175575247
[4-(10,15,20-triphenylporphyrin-5-yl)phenyl]methanol (PubChem CID 175575247) has the molecular formula C45H30N4O and a molecular weight of 642.76 g/mol. Its IUPAC name is [4-(10,15,20-triphenylporphyrin-5-yl)phenyl]methanol.
| Compound Name | [4-(10,15,20-triphenylporphyrin-5-yl)phenyl]methanol |
|---|---|
| PubChem CID | 175575247 |
| Molecular Formula | C45H30N4O |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | [4-(10,15,20-triphenylporphyrin-5-yl)phenyl]methanol |
| SMILES | OCc1ccc(/C2=C3\C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C45H30N4O/c50-28-29-16-18-33(19-17-29)45-40-26-24-38(48-40)43(31-12-6-2-7-13-31)36-22-20-34(46-36)42(30-10-4-1-5-11-30)35-21-23-37(47-35)44(32-14-8-3-9-15-32)39-25-27-41(45)49-39/h1-27,50H,28H2/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | GTRQYPJOJJIUMJ-HIXPDHBDSA-N |
| XLogP | 9.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |