About benzene-1,2-dicarbonitrile;3-methylaniline
benzene-1,2-dicarbonitrile;3-methylaniline (PubChem CID 175575510) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is benzene-1,2-dicarbonitrile;3-methylaniline.
Molecular Properties
| Compound Name | benzene-1,2-dicarbonitrile;3-methylaniline |
| PubChem CID | 175575510 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | benzene-1,2-dicarbonitrile;3-methylaniline |
| SMILES | Cc1cccc(N)c1.N#Cc1ccccc1C#N |
| InChI | InChI=1S/C8H4N2.C7H9N/c9-5-7-3-1-2-4-8(7)6-10;1-6-3-2-4-7(8)5-6/h1-4H;2-5H,8H2,1H3 |
| InChIKey | AYXBZSVLEVGGMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-dicarbonitrile;3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarbonitrile;3-methylaniline?
The IUPAC name of benzene-1,2-dicarbonitrile;3-methylaniline (CID 175575510) is benzene-1,2-dicarbonitrile;3-methylaniline.
What is the SMILES notation for benzene-1,2-dicarbonitrile;3-methylaniline?
The canonical SMILES for benzene-1,2-dicarbonitrile;3-methylaniline is Cc1cccc(N)c1.N#Cc1ccccc1C#N.
What is the InChIKey of benzene-1,2-dicarbonitrile;3-methylaniline?
The InChIKey is AYXBZSVLEVGGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2.C7H9N/c9-5-7-3-1-2-4-8(7)6-10;1-6-3-2-4-7(8)5-6/h1-4H;2-5H,8H2,1H3.
What are the key properties of benzene-1,2-dicarbonitrile;3-methylaniline?
benzene-1,2-dicarbonitrile;3-methylaniline has a molecular weight of 235.29 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarbonitrile;3-methylaniline is sourced from PubChem (CID 175575510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).