About 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid
2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid (PubChem CID 175575614) has the molecular formula C12H10N4O4
and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid |
| PubChem CID | 175575614 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid |
| SMILES | O=C(O)N1Cc2cn(-c3ccc([N+](=O)[O-])cc3)nc2C1 |
| InChI | InChI=1S/C12H10N4O4/c17-12(18)14-5-8-6-15(13-11(8)7-14)9-1-3-10(4-2-9)16(19)20/h1-4,6H,5,7H2,(H,17,18) |
| InChIKey | SHLHJXHWZAWEJR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
The IUPAC name of 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid (CID 175575614) is 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
The canonical SMILES for 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid is O=C(O)N1Cc2cn(-c3ccc([N+](=O)[O-])cc3)nc2C1.
What is the InChIKey of 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
The InChIKey is SHLHJXHWZAWEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O4/c17-12(18)14-5-8-6-15(13-11(8)7-14)9-1-3-10(4-2-9)16(19)20/h1-4,6H,5,7H2,(H,17,18).
What are the key properties of 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid?
2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid has a molecular weight of 274.24 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylic acid is sourced from PubChem (CID 175575614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).