C15H6F7NO2 — CID 175575810
2,2,4-trifluoro-6-(2,3,4,6-tetrafluoro-5-methylphenyl)-1,4-benzoxazin-3-one (PubChem CID 175575810) has the molecular formula C15H6F7NO2 and a molecular weight of 365.20 g/mol. Its IUPAC name is 2,2,4-trifluoro-6-(2,3,4,6-tetrafluoro-5-methylphenyl)-1,4-benzoxazin-3-one.
| Compound Name | 2,2,4-trifluoro-6-(2,3,4,6-tetrafluoro-5-methylphenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 175575810 |
| Molecular Formula | C15H6F7NO2 |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2,2,4-trifluoro-6-(2,3,4,6-tetrafluoro-5-methylphenyl)-1,4-benzoxazin-3-one |
| SMILES | Cc1c(F)c(F)c(F)c(-c2ccc3c(c2)N(F)C(=O)C(F)(F)O3)c1F |
| InChI | InChI=1S/C15H6F7NO2/c1-5-10(16)9(12(18)13(19)11(5)17)6-2-3-8-7(4-6)23(22)14(24)15(20,21)25-8/h2-4H,1H3 |
| InChIKey | MRBDTANBJYRJAS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|