C18H29FN2O3S — CID 175575869
4-[2-[[2-(3-fluorophenyl)-2-hydroxyethyl]amino]-2-methylpropyl]cyclohexane-1-sulfonamide (PubChem CID 175575869) has the molecular formula C18H29FN2O3S and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-[2-[[2-(3-fluorophenyl)-2-hydroxyethyl]amino]-2-methylpropyl]cyclohexane-1-sulfonamide.
| Compound Name | 4-[2-[[2-(3-fluorophenyl)-2-hydroxyethyl]amino]-2-methylpropyl]cyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 175575869 |
| Molecular Formula | C18H29FN2O3S |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 4-[2-[[2-(3-fluorophenyl)-2-hydroxyethyl]amino]-2-methylpropyl]cyclohexane-1-sulfonamide |
| SMILES | CC(C)(CC1CCC(S(N)(=O)=O)CC1)NCC(O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H29FN2O3S/c1-18(2,11-13-6-8-16(9-7-13)25(20,23)24)21-12-17(22)14-4-3-5-15(19)10-14/h3-5,10,13,16-17,21-22H,6-9,11-12H2,1-2H3,(H2,20,23,24) |
| InChIKey | NRXCKZNARMAHLR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |