About 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran
2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran (PubChem CID 175576123) has the molecular formula C15H15F3OS
and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran.
Molecular Properties
| Compound Name | 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran |
| PubChem CID | 175576123 |
| Molecular Formula | C15H15F3OS |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran |
| SMILES | CC1=CC(C)(CC(F)(F)Sc2ccc(F)cc2)OC=C1 |
| InChI | InChI=1S/C15H15F3OS/c1-11-7-8-19-14(2,9-11)10-15(17,18)20-13-5-3-12(16)4-6-13/h3-9H,10H2,1-2H3 |
| InChIKey | HAPMNKMOJWHUDF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran?
The IUPAC name of 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran (CID 175576123) is 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran.
What is the SMILES notation for 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran?
The canonical SMILES for 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran is CC1=CC(C)(CC(F)(F)Sc2ccc(F)cc2)OC=C1.
What is the InChIKey of 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran?
The InChIKey is HAPMNKMOJWHUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3OS/c1-11-7-8-19-14(2,9-11)10-15(17,18)20-13-5-3-12(16)4-6-13/h3-9H,10H2,1-2H3.
What are the key properties of 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran?
2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran has a molecular weight of 300.35 g/mol, XLogP of 5.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoro-2-(4-fluorophenyl)sulfanylethyl]-2,4-dimethylpyran is sourced from PubChem (CID 175576123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).