About 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde
3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde (PubChem CID 175576204) has the molecular formula C18H19ClN2O3
and a molecular weight of 346.81 g/mol. Its IUPAC name is 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde |
| PubChem CID | 175576204 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde |
| SMILES | COc1ccc(C2CCN(C=O)C2)c(C=O)c1.Clc1cccnc1 |
| InChI | InChI=1S/C13H15NO3.C5H4ClN/c1-17-12-2-3-13(11(6-12)8-15)10-4-5-14(7-10)9-16;6-5-2-1-3-7-4-5/h2-3,6,8-10H,4-5,7H2,1H3;1-4H |
| InChIKey | MYZQRZCHPMHIHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde?
The IUPAC name of 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde (CID 175576204) is 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde.
What is the SMILES notation for 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde?
The canonical SMILES for 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde is COc1ccc(C2CCN(C=O)C2)c(C=O)c1.Clc1cccnc1.
What is the InChIKey of 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde?
The InChIKey is MYZQRZCHPMHIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3.C5H4ClN/c1-17-12-2-3-13(11(6-12)8-15)10-4-5-14(7-10)9-16;6-5-2-1-3-7-4-5/h2-3,6,8-10H,4-5,7H2,1H3;1-4H.
What are the key properties of 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde?
3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde has a molecular weight of 346.81 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropyridine;3-(2-formyl-4-methoxyphenyl)pyrrolidine-1-carbaldehyde is sourced from PubChem (CID 175576204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).