C26H22ClN3O6 — CID 175576337
[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1,2-benzoxazol-6-yl]methylideneamino] 2-hydroxybutanoate (PubChem CID 175576337) has the molecular formula C26H22ClN3O6 and a molecular weight of 507.93 g/mol. Its IUPAC name is [[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1,2-benzoxazol-6-yl]methylideneamino] 2-hydroxybutanoate.
| Compound Name | [[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1,2-benzoxazol-6-yl]methylideneamino] 2-hydroxybutanoate |
|---|---|
| PubChem CID | 175576337 |
| Molecular Formula | C26H22ClN3O6 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | [[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1,2-benzoxazol-6-yl]methylideneamino] 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)ON=Cc1ccc2c(Nc3cccc(-c4ccc5c(c4)OCCO5)c3Cl)noc2c1 |
| InChI | InChI=1S/C26H22ClN3O6/c1-2-20(31)26(32)36-28-14-15-6-8-18-22(12-15)35-30-25(18)29-19-5-3-4-17(24(19)27)16-7-9-21-23(13-16)34-11-10-33-21/h3-9,12-14,20,31H,2,10-11H2,1H3,(H,29,30) |
| InChIKey | SLWOEPAMGOPBRC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|