About 3-ethyl-4,5-dimethylfuran-2-ol
3-ethyl-4,5-dimethylfuran-2-ol (PubChem CID 175576907) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 3-ethyl-4,5-dimethylfuran-2-ol.
Molecular Properties
| Compound Name | 3-ethyl-4,5-dimethylfuran-2-ol |
| PubChem CID | 175576907 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3-ethyl-4,5-dimethylfuran-2-ol |
| SMILES | CCc1c(O)oc(C)c1C |
| InChI | InChI=1S/C8H12O2/c1-4-7-5(2)6(3)10-8(7)9/h9H,4H2,1-3H3 |
| InChIKey | VDRJEAAWGCSROC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-4,5-dimethylfuran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-dimethylfuran-2-ol?
The IUPAC name of 3-ethyl-4,5-dimethylfuran-2-ol (CID 175576907) is 3-ethyl-4,5-dimethylfuran-2-ol.
What is the SMILES notation for 3-ethyl-4,5-dimethylfuran-2-ol?
The canonical SMILES for 3-ethyl-4,5-dimethylfuran-2-ol is CCc1c(O)oc(C)c1C.
What is the InChIKey of 3-ethyl-4,5-dimethylfuran-2-ol?
The InChIKey is VDRJEAAWGCSROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-4-7-5(2)6(3)10-8(7)9/h9H,4H2,1-3H3.
What are the key properties of 3-ethyl-4,5-dimethylfuran-2-ol?
3-ethyl-4,5-dimethylfuran-2-ol has a molecular weight of 140.18 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-dimethylfuran-2-ol is sourced from PubChem (CID 175576907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).