About 1-azido-2-phenylbenzene;formamide
1-azido-2-phenylbenzene;formamide (PubChem CID 175577237) has the molecular formula C13H12N4O
and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-azido-2-phenylbenzene;formamide.
Molecular Properties
| Compound Name | 1-azido-2-phenylbenzene;formamide |
| PubChem CID | 175577237 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-azido-2-phenylbenzene;formamide |
| SMILES | NC=O.[N-]=[N+]=Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H9N3.CH3NO/c13-15-14-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1-3/h1-9H;1H,(H2,2,3) |
| InChIKey | CDOOASHRDMTAGX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-2-phenylbenzene;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-2-phenylbenzene;formamide?
The IUPAC name of 1-azido-2-phenylbenzene;formamide (CID 175577237) is 1-azido-2-phenylbenzene;formamide.
What is the SMILES notation for 1-azido-2-phenylbenzene;formamide?
The canonical SMILES for 1-azido-2-phenylbenzene;formamide is NC=O.[N-]=[N+]=Nc1ccccc1-c1ccccc1.
What is the InChIKey of 1-azido-2-phenylbenzene;formamide?
The InChIKey is CDOOASHRDMTAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3.CH3NO/c13-15-14-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1-3/h1-9H;1H,(H2,2,3).
What are the key properties of 1-azido-2-phenylbenzene;formamide?
1-azido-2-phenylbenzene;formamide has a molecular weight of 240.27 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-2-phenylbenzene;formamide is sourced from PubChem (CID 175577237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).