About 1,8-naphthyridine-3,6-dithiol
1,8-naphthyridine-3,6-dithiol (PubChem CID 175577411) has the molecular formula C8H6N2S2
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,8-naphthyridine-3,6-dithiol.
Molecular Properties
| Compound Name | 1,8-naphthyridine-3,6-dithiol |
| PubChem CID | 175577411 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 1,8-naphthyridine-3,6-dithiol |
| SMILES | Sc1cnc2ncc(S)cc2c1 |
| InChI | InChI=1S/C8H6N2S2/c11-6-1-5-2-7(12)4-10-8(5)9-3-6/h1-4,11-12H |
| InChIKey | ZKQKHYIBUCZOFC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,8-naphthyridine-3,6-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-naphthyridine-3,6-dithiol?
The IUPAC name of 1,8-naphthyridine-3,6-dithiol (CID 175577411) is 1,8-naphthyridine-3,6-dithiol.
What is the SMILES notation for 1,8-naphthyridine-3,6-dithiol?
The canonical SMILES for 1,8-naphthyridine-3,6-dithiol is Sc1cnc2ncc(S)cc2c1.
What is the InChIKey of 1,8-naphthyridine-3,6-dithiol?
The InChIKey is ZKQKHYIBUCZOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S2/c11-6-1-5-2-7(12)4-10-8(5)9-3-6/h1-4,11-12H.
What are the key properties of 1,8-naphthyridine-3,6-dithiol?
1,8-naphthyridine-3,6-dithiol has a molecular weight of 194.28 g/mol, XLogP of 2.21, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-naphthyridine-3,6-dithiol is sourced from PubChem (CID 175577411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).