C24H26FNO4 — CID 175577795
[8-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-5,6-dihydronaphthalen-2-yl] hydrogen carbonate (PubChem CID 175577795) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is [8-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-5,6-dihydronaphthalen-2-yl] hydrogen carbonate.
| Compound Name | [8-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-5,6-dihydronaphthalen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 175577795 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [8-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-5,6-dihydronaphthalen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)C(c1ccc(OC3CCN(CCCF)C3)cc1)=CCC2 |
| InChI | InChI=1S/C24H26FNO4/c25-12-2-13-26-14-11-21(16-26)29-19-8-5-18(6-9-19)22-4-1-3-17-7-10-20(15-23(17)22)30-24(27)28/h4-10,15,21H,1-3,11-14,16H2,(H,27,28) |
| InChIKey | DGJCPKXSNLFRLO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|