About [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid
[1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid (PubChem CID 175578019) has the molecular formula C14H25F2NO4
and a molecular weight of 309.35 g/mol. Its IUPAC name is [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid |
| PubChem CID | 175578019 |
| Molecular Formula | C14H25F2NO4 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid |
| SMILES | COCC(F)(F)C1(O)CCC(CC(C)(C)NC(=O)O)CC1 |
| InChI | InChI=1S/C14H25F2NO4/c1-12(2,17-11(18)19)8-10-4-6-13(20,7-5-10)14(15,16)9-21-3/h10,17,20H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | NJDOKLNUNCEIQN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid?
The IUPAC name of [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid (CID 175578019) is [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid.
What is the SMILES notation for [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid?
The canonical SMILES for [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid is COCC(F)(F)C1(O)CCC(CC(C)(C)NC(=O)O)CC1.
What is the InChIKey of [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid?
The InChIKey is NJDOKLNUNCEIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NO4/c1-12(2,17-11(18)19)8-10-4-6-13(20,7-5-10)14(15,16)9-21-3/h10,17,20H,4-9H2,1-3H3,(H,18,19).
What are the key properties of [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid?
[1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid has a molecular weight of 309.35 g/mol, XLogP of 2.63, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(1,1-difluoro-2-methoxyethyl)-4-hydroxycyclohexyl]-2-methylpropan-2-yl]carbamic acid is sourced from PubChem (CID 175578019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).