C32H53NO5 — CID 175578181
3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)oxycarbonylhexanoic acid (PubChem CID 175578181) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)oxycarbonylhexanoic acid.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)oxycarbonylhexanoic acid |
|---|---|
| PubChem CID | 175578181 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(1,2,2,3,3-pentamethylpiperidin-4-yl)oxycarbonylhexanoic acid |
| SMILES | CCCC(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C(=O)O)C(=O)OC1CCN(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C32H53NO5/c1-13-14-21(17-20-18-22(29(2,3)4)26(34)23(19-20)30(5,6)7)25(27(35)36)28(37)38-24-15-16-33(12)32(10,11)31(24,8)9/h18-19,21,24-25,34H,13-17H2,1-12H3,(H,35,36) |
| InChIKey | XSIVABTYURMZHW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|