C18H10F4N3O+ — CID 175578739
3-(8,9-difluoro-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium-7-yl)-2,4-difluorophenol (PubChem CID 175578739) has the molecular formula C18H10F4N3O+ and a molecular weight of 360.29 g/mol. Its IUPAC name is 3-(8,9-difluoro-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium-7-yl)-2,4-difluorophenol.
| Compound Name | 3-(8,9-difluoro-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium-7-yl)-2,4-difluorophenol |
|---|---|
| PubChem CID | 175578739 |
| Molecular Formula | C18H10F4N3O+ |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-(8,9-difluoro-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium-7-yl)-2,4-difluorophenol |
| SMILES | Oc1ccc(F)c(C2=NCc3nccc[n+]3-c3ccc(F)c(F)c32)c1F |
| InChI | InChI=1S/C18H9F4N3O/c19-9-3-5-12(26)17(22)14(9)18-15-11(4-2-10(20)16(15)21)25-7-1-6-23-13(25)8-24-18/h1-7H,8H2/p+1 |
| InChIKey | MPAMPVGHKWXHGU-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 49.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|