About 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid
1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid (PubChem CID 175578862) has the molecular formula C13H18N2O6
and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid |
| PubChem CID | 175578862 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CN1CCCC1=O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C6H9NO.C4H5NO3.C3H4O2/c1-2-7-5-3-4-6(7)8;6-3-1-2-4(7)5(3)8;1-2-3(4)5/h2H,1,3-5H2;8H,1-2H2;2H,1H2,(H,4,5) |
| InChIKey | RGFPMBFCUGTLSR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
The IUPAC name of 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid (CID 175578862) is 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid is C=CC(=O)O.C=CN1CCCC1=O.O=C1CCC(=O)N1O.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
The InChIKey is RGFPMBFCUGTLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H5NO3.C3H4O2/c1-2-7-5-3-4-6(7)8;6-3-1-2-4(7)5(3)8;1-2-3(4)5/h2H,1,3-5H2;8H,1-2H2;2H,1H2,(H,4,5).
What are the key properties of 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid?
1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid has a molecular weight of 298.30 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;1-hydroxypyrrolidine-2,5-dione;prop-2-enoic acid is sourced from PubChem (CID 175578862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).