C17H21N3O5 — CID 175579171
N-hydroxy-6-[(4Z)-4-[(2-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]hexanamide (PubChem CID 175579171) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-hydroxy-6-[(4Z)-4-[(2-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]hexanamide.
| Compound Name | N-hydroxy-6-[(4Z)-4-[(2-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]hexanamide |
|---|---|
| PubChem CID | 175579171 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-hydroxy-6-[(4Z)-4-[(2-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]hexanamide |
| SMILES | COc1ccccc1/C=C1\NC(=O)N(CCCCCC(=O)NO)C1=O |
| InChI | InChI=1S/C17H21N3O5/c1-25-14-8-5-4-7-12(14)11-13-16(22)20(17(23)18-13)10-6-2-3-9-15(21)19-24/h4-5,7-8,11,24H,2-3,6,9-10H2,1H3,(H,18,23)(H,19,21)/b13-11- |
| InChIKey | JORYDNKKHWEMBL-QBFSEMIESA-N |
| XLogP | 1.65 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|