About 1-chloropentane;N-pentylacetohydrazide
1-chloropentane;N-pentylacetohydrazide (PubChem CID 175581019) has the molecular formula C12H27ClN2O
and a molecular weight of 250.81 g/mol. Its IUPAC name is 1-chloropentane;N-pentylacetohydrazide.
Molecular Properties
| Compound Name | 1-chloropentane;N-pentylacetohydrazide |
| PubChem CID | 175581019 |
| Molecular Formula | C12H27ClN2O |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-chloropentane;N-pentylacetohydrazide |
| SMILES | CCCCCCl.CCCCCN(N)C(C)=O |
| InChI | InChI=1S/C7H16N2O.C5H11Cl/c1-3-4-5-6-9(8)7(2)10;1-2-3-4-5-6/h3-6,8H2,1-2H3;2-5H2,1H3 |
| InChIKey | USWMPDGCQUDCCB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;N-pentylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;N-pentylacetohydrazide?
The IUPAC name of 1-chloropentane;N-pentylacetohydrazide (CID 175581019) is 1-chloropentane;N-pentylacetohydrazide.
What is the SMILES notation for 1-chloropentane;N-pentylacetohydrazide?
The canonical SMILES for 1-chloropentane;N-pentylacetohydrazide is CCCCCCl.CCCCCN(N)C(C)=O.
What is the InChIKey of 1-chloropentane;N-pentylacetohydrazide?
The InChIKey is USWMPDGCQUDCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.C5H11Cl/c1-3-4-5-6-9(8)7(2)10;1-2-3-4-5-6/h3-6,8H2,1-2H3;2-5H2,1H3.
What are the key properties of 1-chloropentane;N-pentylacetohydrazide?
1-chloropentane;N-pentylacetohydrazide has a molecular weight of 250.81 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;N-pentylacetohydrazide is sourced from PubChem (CID 175581019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).