About N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide
N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide (PubChem CID 175581112) has the molecular formula C18H17F4N3O2S
and a molecular weight of 415.41 g/mol. Its IUPAC name is N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide |
| PubChem CID | 175581112 |
| Molecular Formula | C18H17F4N3O2S |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide |
| SMILES | CCN(C(c1ccc(F)cc1)C(F)(F)F)S(=O)(=O)c1ccc2ncn(C)c2c1 |
| InChI | InChI=1S/C18H17F4N3O2S/c1-3-25(17(18(20,21)22)12-4-6-13(19)7-5-12)28(26,27)14-8-9-15-16(10-14)24(2)11-23-15/h4-11,17H,3H2,1-2H3 |
| InChIKey | COLDJMKGXKMTGV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide?
The IUPAC name of N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide (CID 175581112) is N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide.
What is the SMILES notation for N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide?
The canonical SMILES for N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide is CCN(C(c1ccc(F)cc1)C(F)(F)F)S(=O)(=O)c1ccc2ncn(C)c2c1.
What is the InChIKey of N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide?
The InChIKey is COLDJMKGXKMTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F4N3O2S/c1-3-25(17(18(20,21)22)12-4-6-13(19)7-5-12)28(26,27)14-8-9-15-16(10-14)24(2)11-23-15/h4-11,17H,3H2,1-2H3.
What are the key properties of N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide?
N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide has a molecular weight of 415.41 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methyl-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]benzimidazole-5-sulfonamide is sourced from PubChem (CID 175581112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).