C16H12Cl2F3N3O2S — CID 175581142
3-chloro-N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylimidazo[1,2-a]pyridine-6-sulfonamide (PubChem CID 175581142) has the molecular formula C16H12Cl2F3N3O2S and a molecular weight of 438.26 g/mol. Its IUPAC name is 3-chloro-N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylimidazo[1,2-a]pyridine-6-sulfonamide.
| Compound Name | 3-chloro-N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylimidazo[1,2-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 175581142 |
| Molecular Formula | C16H12Cl2F3N3O2S |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 3-chloro-N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylimidazo[1,2-a]pyridine-6-sulfonamide |
| SMILES | CN(C(F)(c1ccc(Cl)cc1)C(F)F)S(=O)(=O)c1ccc2ncc(Cl)n2c1 |
| InChI | InChI=1S/C16H12Cl2F3N3O2S/c1-23(16(21,15(19)20)10-2-4-11(17)5-3-10)27(25,26)12-6-7-14-22-8-13(18)24(14)9-12/h2-9,15H,1H3 |
| InChIKey | DZSQMMBEFFUTFA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|