C28H29F3N6O3 — CID 175581412
tert-butyl 4-[1-cyano-2-[N-(cyanomethyl)-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]anilino]ethenyl]piperidine-1-carboxylate (PubChem CID 175581412) has the molecular formula C28H29F3N6O3 and a molecular weight of 554.57 g/mol. Its IUPAC name is tert-butyl 4-[1-cyano-2-[N-(cyanomethyl)-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]anilino]ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-cyano-2-[N-(cyanomethyl)-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]anilino]ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175581412 |
| Molecular Formula | C28H29F3N6O3 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | tert-butyl 4-[1-cyano-2-[N-(cyanomethyl)-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]anilino]ethenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C#N)=CN(CC#N)c2ccc(C(=O)Nc3cc(C(F)(F)F)ccn3)cc2)CC1 |
| InChI | InChI=1S/C28H29F3N6O3/c1-27(2,3)40-26(39)36-13-9-19(10-14-36)21(17-33)18-37(15-11-32)23-6-4-20(5-7-23)25(38)35-24-16-22(8-12-34-24)28(29,30)31/h4-8,12,16,18-19H,9-10,13-15H2,1-3H3,(H,34,35,38) |
| InChIKey | NSGFLLYTVFLCAI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|