About 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid
3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid (PubChem CID 175581523) has the molecular formula C26H21N5O3
and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid |
| PubChem CID | 175581523 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid |
| SMILES | Cc1nn(-c2ccccc2)cc1-c1cc(-c2cn(-c3ccccc3)nc2C)c(O)c(C(=O)O)n1 |
| InChI | InChI=1S/C26H21N5O3/c1-16-21(14-30(28-16)18-9-5-3-6-10-18)20-13-23(27-24(25(20)32)26(33)34)22-15-31(29-17(22)2)19-11-7-4-8-12-19/h3-15,32H,1-2H3,(H,33,34) |
| InChIKey | HFPPWMJUJPFOLY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid?
The IUPAC name of 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid (CID 175581523) is 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid.
What is the SMILES notation for 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid?
The canonical SMILES for 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid is Cc1nn(-c2ccccc2)cc1-c1cc(-c2cn(-c3ccccc3)nc2C)c(O)c(C(=O)O)n1.
What is the InChIKey of 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid?
The InChIKey is HFPPWMJUJPFOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N5O3/c1-16-21(14-30(28-16)18-9-5-3-6-10-18)20-13-23(27-24(25(20)32)26(33)34)22-15-31(29-17(22)2)19-11-7-4-8-12-19/h3-15,32H,1-2H3,(H,33,34).
What are the key properties of 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid?
3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid has a molecular weight of 451.49 g/mol, XLogP of 4.81, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4,6-bis(3-methyl-1-phenylpyrazol-4-yl)pyridine-2-carboxylic acid is sourced from PubChem (CID 175581523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).