C42H39F6N11O6 — CID 175581659
tert-butyl 2,4-bis[4-[[4-(4-methoxycarbonylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 175581659) has the molecular formula C42H39F6N11O6 and a molecular weight of 907.83 g/mol. Its IUPAC name is tert-butyl 2,4-bis[4-[[4-(4-methoxycarbonylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2,4-bis[4-[[4-(4-methoxycarbonylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175581659 |
| Molecular Formula | C42H39F6N11O6 |
| Molecular Weight | 907.83 g/mol |
| Exact Mass | 907.30 |
| IUPAC Name | tert-butyl 2,4-bis[4-[[4-(4-methoxycarbonylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(-c2nc(Nc3cnn(C4CCN(C(=O)OC(C)(C)C)C(n5cc(Nc6ncc(C(F)(F)F)c(-c7ccc(C(=O)OC)cc7)n6)cn5)C4)c3)ncc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C42H39F6N11O6/c1-40(2,3)65-39(62)57-15-14-29(58-21-27(17-51-58)53-37-49-19-30(41(43,44)45)33(55-37)23-6-10-25(11-7-23)35(60)63-4)16-32(57)59-22-28(18-52-59)54-38-50-20-31(42(46,47)48)34(56-38)24-8-12-26(13-9-24)36(61)64-5/h6-13,17-22,29,32H,14-16H2,1-5H3,(H,49,53,55)(H,50,54,56) |
| InChIKey | QUFCTJXKYKDJOR-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.83 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|