C41H49Br2Cl2NO8 — CID 175582415
3',6'-bis[2-bromo-2-[2-(6-chlorohexoxy)ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 175582415) has the molecular formula C41H49Br2Cl2NO8 and a molecular weight of 914.56 g/mol. Its IUPAC name is 3',6'-bis[2-bromo-2-[2-(6-chlorohexoxy)ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-bis[2-bromo-2-[2-(6-chlorohexoxy)ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 175582415 |
| Molecular Formula | C41H49Br2Cl2NO8 |
| Molecular Weight | 914.56 g/mol |
| Exact Mass | 911.12 |
| IUPAC Name | 3',6'-bis[2-bromo-2-[2-(6-chlorohexoxy)ethoxy]ethyl]-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(CC(Br)OCCOCCCCCCCl)cc2Oc2cc(CC(Br)OCCOCCCCCCCl)ccc21 |
| InChI | InChI=1S/C41H49Br2Cl2NO8/c42-37(51-21-19-49-17-7-3-1-5-15-44)25-28-9-13-32-35(23-28)53-36-24-29(26-38(43)52-22-20-50-18-8-4-2-6-16-45)10-14-33(36)41(32)34-27-30(39(46)47)11-12-31(34)40(48)54-41/h9-14,23-24,27,37-38H,1-8,15-22,25-26H2,(H2,46,47) |
| InChIKey | KJMKLDOGXLNDFN-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.56 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|