C7H4ClNO — CID 175582658
4-amino-2-chlorobicyclo[4.1.0]hepta-1(6),2,4-trien-7-one (PubChem CID 175582658) has the molecular formula C7H4ClNO and a molecular weight of 153.57 g/mol. Its IUPAC name is 4-amino-2-chlorobicyclo[4.1.0]hepta-1(6),2,4-trien-7-one.
| Compound Name | 4-amino-2-chlorobicyclo[4.1.0]hepta-1(6),2,4-trien-7-one |
|---|---|
| PubChem CID | 175582658 |
| Molecular Formula | C7H4ClNO |
| Molecular Weight | 153.57 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | 4-amino-2-chlorobicyclo[4.1.0]hepta-1(6),2,4-trien-7-one |
| SMILES | Nc1cc(Cl)c2c(=O)c2c1 |
| InChI | InChI=1S/C7H4ClNO/c8-5-2-3(9)1-4-6(5)7(4)10/h1-2H,9H2 |
| InChIKey | ARYZQDASTDYAOX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|