About 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride
4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride (PubChem CID 175583599) has the molecular formula C9H18ClN
and a molecular weight of 175.70 g/mol. Its IUPAC name is 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride.
Molecular Properties
| Compound Name | 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride |
| PubChem CID | 175583599 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride |
| SMILES | CCCN1C=C(CC)CC1.Cl |
| InChI | InChI=1S/C9H17N.ClH/c1-3-6-10-7-5-9(4-2)8-10;/h8H,3-7H2,1-2H3;1H |
| InChIKey | WXJQECYMUHTRAK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride?
The IUPAC name of 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride (CID 175583599) is 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride.
What is the SMILES notation for 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride?
The canonical SMILES for 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride is CCCN1C=C(CC)CC1.Cl.
What is the InChIKey of 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride?
The InChIKey is WXJQECYMUHTRAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.ClH/c1-3-6-10-7-5-9(4-2)8-10;/h8H,3-7H2,1-2H3;1H.
What are the key properties of 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride?
4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride has a molecular weight of 175.70 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-propyl-2,3-dihydropyrrole;hydrochloride is sourced from PubChem (CID 175583599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).