About 1,2-diethyl-3-methylpyrrolidine;hydrofluoride
1,2-diethyl-3-methylpyrrolidine;hydrofluoride (PubChem CID 175583958) has the molecular formula C9H20FN
and a molecular weight of 161.26 g/mol. Its IUPAC name is 1,2-diethyl-3-methylpyrrolidine;hydrofluoride.
Molecular Properties
| Compound Name | 1,2-diethyl-3-methylpyrrolidine;hydrofluoride |
| PubChem CID | 175583958 |
| Molecular Formula | C9H20FN |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | 1,2-diethyl-3-methylpyrrolidine;hydrofluoride |
| SMILES | CCC1C(C)CCN1CC.F |
| InChI | InChI=1S/C9H19N.FH/c1-4-9-8(3)6-7-10(9)5-2;/h8-9H,4-7H2,1-3H3;1H |
| InChIKey | QNRBSVPSBJHJIS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-diethyl-3-methylpyrrolidine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-3-methylpyrrolidine;hydrofluoride?
The IUPAC name of 1,2-diethyl-3-methylpyrrolidine;hydrofluoride (CID 175583958) is 1,2-diethyl-3-methylpyrrolidine;hydrofluoride.
What is the SMILES notation for 1,2-diethyl-3-methylpyrrolidine;hydrofluoride?
The canonical SMILES for 1,2-diethyl-3-methylpyrrolidine;hydrofluoride is CCC1C(C)CCN1CC.F.
What is the InChIKey of 1,2-diethyl-3-methylpyrrolidine;hydrofluoride?
The InChIKey is QNRBSVPSBJHJIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.FH/c1-4-9-8(3)6-7-10(9)5-2;/h8-9H,4-7H2,1-3H3;1H.
What are the key properties of 1,2-diethyl-3-methylpyrrolidine;hydrofluoride?
1,2-diethyl-3-methylpyrrolidine;hydrofluoride has a molecular weight of 161.26 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-3-methylpyrrolidine;hydrofluoride is sourced from PubChem (CID 175583958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).