1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid

C10H10N2O2 — CID 175584211

IUPAC1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid
SMILESCc1cc2c(cn1)cc(C(=O)O)n2C
InChIInChI=1S/C10H10N2O2/c1-6-3-8-7(5-11-6)4-9(10(13)14)12(8)2/h3-5H,1-2H3,(H,13,14)
InChIKeyPYNQWJXPGJJQOY-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.58
Rot. Bonds1

About 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid

1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid (PubChem CID 175584211) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid.

Molecular Properties

Compound Name1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid
PubChem CID175584211
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Name1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid
SMILESCc1cc2c(cn1)cc(C(=O)O)n2C
InChIInChI=1S/C10H10N2O2/c1-6-3-8-7(5-11-6)4-9(10(13)14)12(8)2/h3-5H,1-2H3,(H,13,14)
InChIKeyPYNQWJXPGJJQOY-UHFFFAOYSA-N
XLogP1.58
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid?
The IUPAC name of 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid (CID 175584211) is 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid.
What is the SMILES notation for 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid?
The canonical SMILES for 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid is Cc1cc2c(cn1)cc(C(=O)O)n2C.
What is the InChIKey of 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid?
The InChIKey is PYNQWJXPGJJQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-3-8-7(5-11-6)4-9(10(13)14)12(8)2/h3-5H,1-2H3,(H,13,14).
What are the key properties of 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid?
1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid has a molecular weight of 190.20 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethylpyrrolo[3,2-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 175584211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).