About 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide
5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 175584230) has the molecular formula C12H16F2N2O2
and a molecular weight of 258.27 g/mol. Its IUPAC name is 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 175584230 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(CC2CCC(F)(F)CC2)c1C(N)=O |
| InChI | InChI=1S/C12H16F2N2O2/c1-7-10(11(15)17)9(18-16-7)6-8-2-4-12(13,14)5-3-8/h8H,2-6H2,1H3,(H2,15,17) |
| InChIKey | JCUJDMKXCBHRRE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide (CID 175584230) is 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide is Cc1noc(CC2CCC(F)(F)CC2)c1C(N)=O.
What is the InChIKey of 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is JCUJDMKXCBHRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2N2O2/c1-7-10(11(15)17)9(18-16-7)6-8-2-4-12(13,14)5-3-8/h8H,2-6H2,1H3,(H2,15,17).
What are the key properties of 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide?
5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 258.27 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,4-difluorocyclohexyl)methyl]-3-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 175584230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).