C17H40Si6 — CID 175584555
[3-(1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl)-1,1-disilyl-2-(trisilylmethyl)but-2-enyl]silane (PubChem CID 175584555) has the molecular formula C17H40Si6 and a molecular weight of 413.02 g/mol. Its IUPAC name is [3-(1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl)-1,1-disilyl-2-(trisilylmethyl)but-2-enyl]silane.
| Compound Name | [3-(1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl)-1,1-disilyl-2-(trisilylmethyl)but-2-enyl]silane |
|---|---|
| PubChem CID | 175584555 |
| Molecular Formula | C17H40Si6 |
| Molecular Weight | 413.02 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [3-(1,2,3,4,5,6-hexamethylcyclohexa-2,4-dien-1-yl)-1,1-disilyl-2-(trisilylmethyl)but-2-enyl]silane |
| SMILES | CC1=C(C)C(C)C(C)(C(C)=C(C([SiH3])([SiH3])[SiH3])C([SiH3])([SiH3])[SiH3])C(C)=C1C |
| InChI | InChI=1S/C17H40Si6/c1-8-9(2)11(4)15(7,12(5)10(8)3)13(6)14(16(18,19)20)17(21,22)23/h11H,1-7,18-23H3 |
| InChIKey | UOLRBQMOAFSNNP-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.02 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|