sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine

C6H16N2O3S — CID 175584901

IUPACsulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine
SMILESCN(C)CCN(C)C.O=S(=O)=O
InChIInChI=1S/C6H16N2.O3S/c1-7(2)5-6-8(3)4;1-4(2)3/h5-6H2,1-4H3;
InChIKeyIWFTXLGTXVMMFO-UHFFFAOYSA-N
MW196.27 g/mol
LogP-0.89
Rot. Bonds3

About sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine

sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 175584901) has the molecular formula C6H16N2O3S and a molecular weight of 196.27 g/mol. Its IUPAC name is sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine.

Molecular Properties

Compound Namesulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine
PubChem CID175584901
Molecular FormulaC6H16N2O3S
Molecular Weight196.27 g/mol
Exact Mass196.09
IUPAC Namesulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine
SMILESCN(C)CCN(C)C.O=S(=O)=O
InChIInChI=1S/C6H16N2.O3S/c1-7(2)5-6-8(3)4;1-4(2)3/h5-6H2,1-4H3;
InChIKeyIWFTXLGTXVMMFO-UHFFFAOYSA-N
XLogP-0.89
TPSA57.69 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.27
LogP ≤ 5-0.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The IUPAC name of sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine (CID 175584901) is sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine.
What is the SMILES notation for sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The canonical SMILES for sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine is CN(C)CCN(C)C.O=S(=O)=O.
What is the InChIKey of sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
The InChIKey is IWFTXLGTXVMMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.O3S/c1-7(2)5-6-8(3)4;1-4(2)3/h5-6H2,1-4H3;.
What are the key properties of sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine?
sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine has a molecular weight of 196.27 g/mol, XLogP of -0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur trioxide;N,N,N',N'-tetramethylethane-1,2-diamine is sourced from PubChem (CID 175584901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).