About sodium;hydride;hydroxy(phenyl)silane
sodium;hydride;hydroxy(phenyl)silane (PubChem CID 175585025) has the molecular formula C6H9NaOSi
and a molecular weight of 148.21 g/mol. Its IUPAC name is sodium;hydride;hydroxy(phenyl)silane.
Molecular Properties
| Compound Name | sodium;hydride;hydroxy(phenyl)silane |
| PubChem CID | 175585025 |
| Molecular Formula | C6H9NaOSi |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | sodium;hydride;hydroxy(phenyl)silane |
| SMILES | O[SiH2]c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C6H8OSi.Na.H/c7-8-6-4-2-1-3-5-6;;/h1-5,7H,8H2;;/q;+1;-1 |
| InChIKey | IJWAEMWJADHMLW-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;hydroxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;hydroxy(phenyl)silane?
The IUPAC name of sodium;hydride;hydroxy(phenyl)silane (CID 175585025) is sodium;hydride;hydroxy(phenyl)silane.
What is the SMILES notation for sodium;hydride;hydroxy(phenyl)silane?
The canonical SMILES for sodium;hydride;hydroxy(phenyl)silane is O[SiH2]c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;hydroxy(phenyl)silane?
The InChIKey is IJWAEMWJADHMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OSi.Na.H/c7-8-6-4-2-1-3-5-6;;/h1-5,7H,8H2;;/q;+1;-1.
What are the key properties of sodium;hydride;hydroxy(phenyl)silane?
sodium;hydride;hydroxy(phenyl)silane has a molecular weight of 148.21 g/mol, XLogP of -3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;hydroxy(phenyl)silane is sourced from PubChem (CID 175585025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).