About 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane
2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane (PubChem CID 175585074) has the molecular formula C14H34N2O8SSi
and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane |
| PubChem CID | 175585074 |
| Molecular Formula | C14H34N2O8SSi |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane |
| SMILES | CCCOS(=O)(=O)[Si](OCC)(OCC)OCC.CN(C)CCNC(=O)O |
| InChI | InChI=1S/C9H22O6SSi.C5H12N2O2/c1-5-9-12-16(10,11)17(13-6-2,14-7-3)15-8-4;1-7(2)4-3-6-5(8)9/h5-9H2,1-4H3;6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | NVNMSBKGNACCHG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane?
The IUPAC name of 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane (CID 175585074) is 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane.
What is the SMILES notation for 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane?
The canonical SMILES for 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane is CCCOS(=O)(=O)[Si](OCC)(OCC)OCC.CN(C)CCNC(=O)O.
What is the InChIKey of 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane?
The InChIKey is NVNMSBKGNACCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O6SSi.C5H12N2O2/c1-5-9-12-16(10,11)17(13-6-2,14-7-3)15-8-4;1-7(2)4-3-6-5(8)9/h5-9H2,1-4H3;6H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane?
2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane has a molecular weight of 418.59 g/mol, XLogP of 1.10, 13 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethylcarbamic acid;1-triethoxysilylsulfonyloxypropane is sourced from PubChem (CID 175585074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).