C10H16O3 — CID 175586325
2-tert-butylcyclohexa-3,5-diene-1,2,4-triol (PubChem CID 175586325) has the molecular formula C10H16O3 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-tert-butylcyclohexa-3,5-diene-1,2,4-triol.
| Compound Name | 2-tert-butylcyclohexa-3,5-diene-1,2,4-triol |
|---|---|
| PubChem CID | 175586325 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-tert-butylcyclohexa-3,5-diene-1,2,4-triol |
| SMILES | CC(C)(C)C1(O)C=C(O)C=CC1O |
| InChI | InChI=1S/C10H16O3/c1-9(2,3)10(13)6-7(11)4-5-8(10)12/h4-6,8,11-13H,1-3H3 |
| InChIKey | LJEOYPGNSITYSA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |